C16H25NO4 — CID 120547875
2-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]amino]-2-(oxan-3-yl)acetic acid (PubChem CID 120547875) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]amino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]amino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120547875 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[[2-(2-bicyclo[2.2.1]heptanyl)acetyl]amino]-2-(oxan-3-yl)acetic acid |
| SMILES | O=C(CC1CC2CCC1C2)NC(C(=O)O)C1CCCOC1 |
| InChI | InChI=1S/C16H25NO4/c18-14(8-13-7-10-3-4-11(13)6-10)17-15(16(19)20)12-2-1-5-21-9-12/h10-13,15H,1-9H2,(H,17,18)(H,19,20) |
| InChIKey | CRTRUMXWZNGSBG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |