C10H17N3O4S — CID 61199681
2-[[2-[[methyl(thiolan-3-yl)carbamoyl]amino]acetyl]amino]acetic acid (PubChem CID 61199681) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-[[2-[[methyl(thiolan-3-yl)carbamoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[methyl(thiolan-3-yl)carbamoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 61199681 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-[[2-[[methyl(thiolan-3-yl)carbamoyl]amino]acetyl]amino]acetic acid |
| SMILES | CN(C(=O)NCC(=O)NCC(=O)O)C1CCSC1 |
| InChI | InChI=1S/C10H17N3O4S/c1-13(7-2-3-18-6-7)10(17)12-4-8(14)11-5-9(15)16/h7H,2-6H2,1H3,(H,11,14)(H,12,17)(H,15,16) |
| InChIKey | JGKHNALZHJNSRP-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |