C15H16N2O3 — CID 61209553
methyl (2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]propanoate (PubChem CID 61209553) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl (2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 61209553 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | methyl (2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)c1cc2ccccc2cc1N |
| InChI | InChI=1S/C15H16N2O3/c1-9(15(19)20-2)17-14(18)12-7-10-5-3-4-6-11(10)8-13(12)16/h3-9H,16H2,1-2H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | UZSROLGZQNILCY-VIFPVBQESA-N |
| XLogP | 1.71 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|