C21H24ClF3N2O3 — CID 57450480
methyl 2-[(3-aminonaphthalene-2-carbonyl)amino]-2-[4-(trifluoromethyl)cyclohexyl]acetate;hydrochloride (PubChem CID 57450480) has the molecular formula C21H24ClF3N2O3 and a molecular weight of 444.88 g/mol. Its IUPAC name is methyl 2-[(3-aminonaphthalene-2-carbonyl)amino]-2-[4-(trifluoromethyl)cyclohexyl]acetate;hydrochloride.
| Compound Name | methyl 2-[(3-aminonaphthalene-2-carbonyl)amino]-2-[4-(trifluoromethyl)cyclohexyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 57450480 |
| Molecular Formula | C21H24ClF3N2O3 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | methyl 2-[(3-aminonaphthalene-2-carbonyl)amino]-2-[4-(trifluoromethyl)cyclohexyl]acetate;hydrochloride |
| SMILES | COC(=O)C(NC(=O)c1cc2ccccc2cc1N)C1CCC(C(F)(F)F)CC1.Cl |
| InChI | InChI=1S/C21H23F3N2O3.ClH/c1-29-20(28)18(12-6-8-15(9-7-12)21(22,23)24)26-19(27)16-10-13-4-2-3-5-14(13)11-17(16)25;/h2-5,10-12,15,18H,6-9,25H2,1H3,(H,26,27);1H |
| InChIKey | MFDOWKWZORXBCJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|