C21H27ClN2O3 — CID 69433167
(2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]-2-(4-methylcyclohexyl)propanoic acid;hydrochloride (PubChem CID 69433167) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is (2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]-2-(4-methylcyclohexyl)propanoic acid;hydrochloride.
| Compound Name | (2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]-2-(4-methylcyclohexyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 69433167 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]-2-(4-methylcyclohexyl)propanoic acid;hydrochloride |
| SMILES | CC1CCC([C@](C)(NC(=O)c2cc3ccccc3cc2N)C(=O)O)CC1.Cl |
| InChI | InChI=1S/C21H26N2O3.ClH/c1-13-7-9-16(10-8-13)21(2,20(25)26)23-19(24)17-11-14-5-3-4-6-15(14)12-18(17)22;/h3-6,11-13,16H,7-10,22H2,1-2H3,(H,23,24)(H,25,26);1H/t13?,16?,21-;/m0./s1 |
| InChIKey | OANBQZJAEFCBQW-FOVMTTCFSA-N |
| XLogP | 4.24 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|