C19H20F2N2O3 — CID 69349459
(2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]-2-(4,4-difluorocyclohexyl)acetic acid (PubChem CID 69349459) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is (2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]-2-(4,4-difluorocyclohexyl)acetic acid.
| Compound Name | (2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]-2-(4,4-difluorocyclohexyl)acetic acid |
|---|---|
| PubChem CID | 69349459 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2S)-2-[(3-aminonaphthalene-2-carbonyl)amino]-2-(4,4-difluorocyclohexyl)acetic acid |
| SMILES | Nc1cc2ccccc2cc1C(=O)N[C@H](C(=O)O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H20F2N2O3/c20-19(21)7-5-11(6-8-19)16(18(25)26)23-17(24)14-9-12-3-1-2-4-13(12)10-15(14)22/h1-4,9-11,16H,5-8,22H2,(H,23,24)(H,25,26)/t16-/m0/s1 |
| InChIKey | WWBQXMUVTLLFAF-INIZCTEOSA-N |
| XLogP | 3.43 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|