C22H14BrCl2NO4 — CID 6121353
(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 6121353) has the molecular formula C22H14BrCl2NO4 and a molecular weight of 507.17 g/mol. Its IUPAC name is (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6121353 |
| Molecular Formula | C22H14BrCl2NO4 |
| Molecular Weight | 507.17 g/mol |
| Exact Mass | 504.95 |
| IUPAC Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccco2)C(c2ccc(Cl)c(Cl)c2)/C1=C(\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H14BrCl2NO4/c23-14-6-3-12(4-7-14)20(27)18-19(13-5-8-16(24)17(25)10-13)26(22(29)21(18)28)11-15-2-1-9-30-15/h1-10,19,27H,11H2/b20-18+ |
| InChIKey | JBLUVBSZNLKSSL-CZIZESTLSA-N |
| XLogP | 5.97 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.17 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|