C13H17N3O3 — CID 61214741
N-(4-carbamoylphenyl)-4-methoxypyrrolidine-2-carboxamide (PubChem CID 61214741) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-4-methoxypyrrolidine-2-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-4-methoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 61214741 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(4-carbamoylphenyl)-4-methoxypyrrolidine-2-carboxamide |
| SMILES | COC1CNC(C(=O)Nc2ccc(C(N)=O)cc2)C1 |
| InChI | InChI=1S/C13H17N3O3/c1-19-10-6-11(15-7-10)13(18)16-9-4-2-8(3-5-9)12(14)17/h2-5,10-11,15H,6-7H2,1H3,(H2,14,17)(H,16,18) |
| InChIKey | AAODKMTXIUHENE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |