C12H13F3N2O2 — CID 62813538
4-methoxy-N-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxamide (PubChem CID 62813538) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4-methoxy-N-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | 4-methoxy-N-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 62813538 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-methoxy-N-(3,4,5-trifluorophenyl)pyrrolidine-2-carboxamide |
| SMILES | COC1CNC(C(=O)Nc2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C12H13F3N2O2/c1-19-7-4-10(16-5-7)12(18)17-6-2-8(13)11(15)9(14)3-6/h2-3,7,10,16H,4-5H2,1H3,(H,17,18) |
| InChIKey | YKAYZJMOXMKGEX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|