C16H31N3O2 — CID 61215241
(4-methoxypyrrolidin-2-yl)-[4-[[methyl(propan-2-yl)amino]methyl]piperidin-1-yl]methanone (PubChem CID 61215241) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is (4-methoxypyrrolidin-2-yl)-[4-[[methyl(propan-2-yl)amino]methyl]piperidin-1-yl]methanone.
| Compound Name | (4-methoxypyrrolidin-2-yl)-[4-[[methyl(propan-2-yl)amino]methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 61215241 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | (4-methoxypyrrolidin-2-yl)-[4-[[methyl(propan-2-yl)amino]methyl]piperidin-1-yl]methanone |
| SMILES | COC1CNC(C(=O)N2CCC(CN(C)C(C)C)CC2)C1 |
| InChI | InChI=1S/C16H31N3O2/c1-12(2)18(3)11-13-5-7-19(8-6-13)16(20)15-9-14(21-4)10-17-15/h12-15,17H,5-11H2,1-4H3 |
| InChIKey | HACLKZACAZDOEA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |