C11H9F3N4O2 — CID 61216433
2-oxo-N-(1H-pyrazol-5-ylmethyl)-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 61216433) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-oxo-N-(1H-pyrazol-5-ylmethyl)-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-(1H-pyrazol-5-ylmethyl)-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 61216433 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-oxo-N-(1H-pyrazol-5-ylmethyl)-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccn[nH]1)c1ccc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C11H9F3N4O2/c12-11(13,14)8-2-1-7(10(20)17-8)9(19)15-5-6-3-4-16-18-6/h1-4H,5H2,(H,15,19)(H,16,18)(H,17,20) |
| InChIKey | YWANQFQHLWJCBV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |