C30H26Cl2N2O4S — CID 6122626
(4E)-4-[(3-butoxyphenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 6122626) has the molecular formula C30H26Cl2N2O4S and a molecular weight of 581.52 g/mol. Its IUPAC name is (4E)-4-[(3-butoxyphenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-butoxyphenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6122626 |
| Molecular Formula | C30H26Cl2N2O4S |
| Molecular Weight | 581.52 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | (4E)-4-[(3-butoxyphenyl)-hydroxymethylidene]-5-(3,4-dichlorophenyl)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCCCOc1cccc(/C(O)=C2\C(=O)C(=O)N(c3nc4c(C)cc(C)cc4s3)C2c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C30H26Cl2N2O4S/c1-4-5-11-38-20-8-6-7-19(14-20)27(35)24-26(18-9-10-21(31)22(32)15-18)34(29(37)28(24)36)30-33-25-17(3)12-16(2)13-23(25)39-30/h6-10,12-15,26,35H,4-5,11H2,1-3H3/b27-24+ |
| InChIKey | WVAAPDZCIVJZHX-SOYKGTTHSA-N |
| XLogP | 8.03 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.52 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|