C32H30N2O6S — CID 6122739
methyl 4-[(3E)-3-[(3-butoxyphenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 6122739) has the molecular formula C32H30N2O6S and a molecular weight of 570.67 g/mol. Its IUPAC name is methyl 4-[(3E)-3-[(3-butoxyphenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(3E)-3-[(3-butoxyphenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 6122739 |
| Molecular Formula | C32H30N2O6S |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | methyl 4-[(3E)-3-[(3-butoxyphenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | CCCCOc1cccc(/C(O)=C2\C(=O)C(=O)N(c3nc4c(C)cc(C)cc4s3)C2c2ccc(C(=O)OC)cc2)c1 |
| InChI | InChI=1S/C32H30N2O6S/c1-5-6-14-40-23-9-7-8-22(17-23)28(35)25-27(20-10-12-21(13-11-20)31(38)39-4)34(30(37)29(25)36)32-33-26-19(3)15-18(2)16-24(26)41-32/h7-13,15-17,27,35H,5-6,14H2,1-4H3/b28-25+ |
| InChIKey | RCIYEHKYRJQBOR-AZPGRJICSA-N |
| XLogP | 6.50 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|