C29H24N2O5S — CID 40977893
methyl 4-[(2R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 40977893) has the molecular formula C29H24N2O5S and a molecular weight of 512.59 g/mol. Its IUPAC name is methyl 4-[(2R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 40977893 |
| Molecular Formula | C29H24N2O5S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | methyl 4-[(2R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-[hydroxy-(4-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C(=C(O)c3ccc(C)cc3)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)cc1 |
| InChI | InChI=1S/C29H24N2O5S/c1-15-5-7-19(8-6-15)25(32)22-24(18-9-11-20(12-10-18)28(35)36-4)31(27(34)26(22)33)29-30-23-17(3)13-16(2)14-21(23)37-29/h5-14,24,32H,1-4H3/t24-/m1/s1 |
| InChIKey | MMZGIJOLZNTJPU-XMMPIXPASA-N |
| XLogP | 5.63 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|