C30H28N2O3S — CID 40893754
(5R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 40893754) has the molecular formula C30H28N2O3S and a molecular weight of 496.63 g/mol. Its IUPAC name is (5R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 40893754 |
| Molecular Formula | C30H28N2O3S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | (5R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C(O)=C2C(=O)C(=O)N(c3nc4c(C)cc(C)cc4s3)[C@@H]2c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O3S/c1-16(2)20-10-12-21(13-11-20)26-24(27(33)22-8-6-17(3)7-9-22)28(34)29(35)32(26)30-31-25-19(5)14-18(4)15-23(25)36-30/h6-16,26,33H,1-5H3/t26-/m1/s1 |
| InChIKey | GSQRSFCZXKZBKG-AREMUKBSSA-N |
| XLogP | 6.97 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|