2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid

C6H11NO3S — CID 6122729

IUPAC2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid
SMILESC/C=C\S(=O)CC(N)C(=O)O
InChIInChI=1S/C6H11NO3S/c1-2-3-11(10)4-5(7)6(8)9/h2-3,5H,4,7H2,1H3,(H,8,9)/b3-2-
InChIKeyOKYHUOHBRKWCQJ-IHWYPQMZSA-N
MW177.23 g/mol
LogP-0.32
Rot. Bonds4

About 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid

2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid (PubChem CID 6122729) has the molecular formula C6H11NO3S and a molecular weight of 177.23 g/mol. Its IUPAC name is 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid.

Molecular Properties

Compound Name2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid
PubChem CID6122729
Molecular FormulaC6H11NO3S
Molecular Weight177.23 g/mol
Exact Mass177.05
IUPAC Name2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid
SMILESC/C=C\S(=O)CC(N)C(=O)O
InChIInChI=1S/C6H11NO3S/c1-2-3-11(10)4-5(7)6(8)9/h2-3,5H,4,7H2,1H3,(H,8,9)/b3-2-
InChIKeyOKYHUOHBRKWCQJ-IHWYPQMZSA-N
XLogP-0.32
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.23
LogP ≤ 5-0.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-amino-5-[[1-carboxy-2-[(Z)-prop-1-enyl]sulfinylethyl]amino]-5-oxopentanoic acid
CID 5317734
(Z,2S)-2-aminohex-4-enoic acid
CID 91998876
2-amino-3-pentylsulfinylpropanoic acid
CID 103846087
2-amino-3-(3-hydroxypropylsulfinyl)propanoic acid
CID 74324894
2-[(2R)-2-amino-2-carboxyethyl]sulfinylbutanoic acid
CID 153344560
2-aminohept-5-enoic acid
CID 54178727
2-amino-3-(2-hydroxyethylsulfinyl)propanoic acid
CID 74324904
2-[(2R)-2-amino-2-carboxyethyl]sulfinyl-4-methylpentanoic acid
CID 24820522
(2R)-2-amino-3-but-3-enylsulfinylpropanoic acid
CID 132934359
2-amino-4-ethylidenehept-5-enoic acid
CID 123282783
(2S)-2-amino-3-[[(E)-prop-1-enyl]disulfanyl]propanoic acid
CID 15003857
(2S)-2-amino-4-methylhex-4-enoic acid
CID 70268414

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid?
The IUPAC name of 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid (CID 6122729) is 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid.
What is the SMILES notation for 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid?
The canonical SMILES for 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid is C/C=C\S(=O)CC(N)C(=O)O.
What is the InChIKey of 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid?
The InChIKey is OKYHUOHBRKWCQJ-IHWYPQMZSA-N. The full InChI is InChI=1S/C6H11NO3S/c1-2-3-11(10)4-5(7)6(8)9/h2-3,5H,4,7H2,1H3,(H,8,9)/b3-2-.
What are the key properties of 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid?
2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid has a molecular weight of 177.23 g/mol, XLogP of -0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(Z)-prop-1-enyl]sulfinylpropanoic acid is sourced from PubChem (CID 6122729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).