C6H11NO2S2 — CID 15003857
(2S)-2-amino-3-[[(E)-prop-1-enyl]disulfanyl]propanoic acid (PubChem CID 15003857) has the molecular formula C6H11NO2S2 and a molecular weight of 193.29 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(E)-prop-1-enyl]disulfanyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[[(E)-prop-1-enyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 15003857 |
| Molecular Formula | C6H11NO2S2 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | (2S)-2-amino-3-[[(E)-prop-1-enyl]disulfanyl]propanoic acid |
| SMILES | C/C=C/SSC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H11NO2S2/c1-2-3-10-11-4-5(7)6(8)9/h2-3,5H,4,7H2,1H3,(H,8,9)/b3-2+/t5-/m1/s1 |
| InChIKey | UONBGLRRZCOLDM-WVSAJJKCSA-N |
| XLogP | 1.31 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|