C11H17N3O3 — CID 61235651
N,N-bis(2-hydroxyethyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide (PubChem CID 61235651) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 61235651 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3-(2-methylpyrazol-3-yl)prop-2-enamide |
| SMILES | Cn1nccc1C=CC(=O)N(CCO)CCO |
| InChI | InChI=1S/C11H17N3O3/c1-13-10(4-5-12-13)2-3-11(17)14(6-8-15)7-9-16/h2-5,15-16H,6-9H2,1H3 |
| InChIKey | VSEVFSZGPZMRNK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|