C16H22BrN3O — CID 61236329
2-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)-N-(4-bromo-3-methylphenyl)acetamide (PubChem CID 61236329) has the molecular formula C16H22BrN3O and a molecular weight of 352.28 g/mol. Its IUPAC name is 2-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)-N-(4-bromo-3-methylphenyl)acetamide.
| Compound Name | 2-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)-N-(4-bromo-3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 61236329 |
| Molecular Formula | C16H22BrN3O |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)-N-(4-bromo-3-methylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CN2C3CCC2CC(N)C3)ccc1Br |
| InChI | InChI=1S/C16H22BrN3O/c1-10-6-12(2-5-15(10)17)19-16(21)9-20-13-3-4-14(20)8-11(18)7-13/h2,5-6,11,13-14H,3-4,7-9,18H2,1H3,(H,19,21) |
| InChIKey | DWNRAQREMSLUIB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |