C19H20Br2N2O2 — CID 6123992
2-(2,4-dibromophenoxy)-N-[(E)-1-phenylpentylideneamino]acetamide (PubChem CID 6123992) has the molecular formula C19H20Br2N2O2 and a molecular weight of 468.19 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-[(E)-1-phenylpentylideneamino]acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-[(E)-1-phenylpentylideneamino]acetamide |
|---|---|
| PubChem CID | 6123992 |
| Molecular Formula | C19H20Br2N2O2 |
| Molecular Weight | 468.19 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-[(E)-1-phenylpentylideneamino]acetamide |
| SMILES | CCCC/C(=N\NC(=O)COc1ccc(Br)cc1Br)c1ccccc1 |
| InChI | InChI=1S/C19H20Br2N2O2/c1-2-3-9-17(14-7-5-4-6-8-14)22-23-19(24)13-25-18-11-10-15(20)12-16(18)21/h4-8,10-12H,2-3,9,13H2,1H3,(H,23,24)/b22-17+ |
| InChIKey | HLWBVRHSKXSGLZ-OQKWZONESA-N |
| XLogP | 5.30 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.19 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|