C15H18Br2N2O4 — CID 6124106
ethyl (3Z)-3-[[2-(2,4-dibromophenoxy)acetyl]hydrazinylidene]-2-methylbutanoate (PubChem CID 6124106) has the molecular formula C15H18Br2N2O4 and a molecular weight of 450.13 g/mol. Its IUPAC name is ethyl (3Z)-3-[[2-(2,4-dibromophenoxy)acetyl]hydrazinylidene]-2-methylbutanoate.
| Compound Name | ethyl (3Z)-3-[[2-(2,4-dibromophenoxy)acetyl]hydrazinylidene]-2-methylbutanoate |
|---|---|
| PubChem CID | 6124106 |
| Molecular Formula | C15H18Br2N2O4 |
| Molecular Weight | 450.13 g/mol |
| Exact Mass | 447.96 |
| IUPAC Name | ethyl (3Z)-3-[[2-(2,4-dibromophenoxy)acetyl]hydrazinylidene]-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)/C(C)=N\NC(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H18Br2N2O4/c1-4-22-15(21)9(2)10(3)18-19-14(20)8-23-13-6-5-11(16)7-12(13)17/h5-7,9H,4,8H2,1-3H3,(H,19,20)/b18-10- |
| InChIKey | UJUOBUFCXCNLMS-ZDLGFXPLSA-N |
| XLogP | 3.28 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.13 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|