4-piperazin-1-ylpiperidine-4-carboxylic acid

C10H19N3O2 — CID 61242816

IUPAC4-piperazin-1-ylpiperidine-4-carboxylic acid
SMILESO=C(O)C1(N2CCNCC2)CCNCC1
InChIInChI=1S/C10H19N3O2/c14-9(15)10(1-3-11-4-2-10)13-7-5-12-6-8-13/h11-12H,1-8H2,(H,14,15)
InChIKeyHPYAUWCUNUYIDG-UHFFFAOYSA-N
MW213.28 g/mol
LogP-0.90
Rot. Bonds2

About 4-piperazin-1-ylpiperidine-4-carboxylic acid

4-piperazin-1-ylpiperidine-4-carboxylic acid (PubChem CID 61242816) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-piperazin-1-ylpiperidine-4-carboxylic acid.

Molecular Properties

Compound Name4-piperazin-1-ylpiperidine-4-carboxylic acid
PubChem CID61242816
Molecular FormulaC10H19N3O2
Molecular Weight213.28 g/mol
Exact Mass213.15
IUPAC Name4-piperazin-1-ylpiperidine-4-carboxylic acid
SMILESO=C(O)C1(N2CCNCC2)CCNCC1
InChIInChI=1S/C10H19N3O2/c14-9(15)10(1-3-11-4-2-10)13-7-5-12-6-8-13/h11-12H,1-8H2,(H,14,15)
InChIKeyHPYAUWCUNUYIDG-UHFFFAOYSA-N
XLogP-0.90
TPSA64.60 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.28
LogP ≤ 5-0.90
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-piperazin-1-ylpiperidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-(Piperidin-1-yl)piperidine-4-carboxylic acid
CID 22185355
4-Morpholin-4-yl-piperidine-4-carboxylic acid
CID 3159697
Bis-[2-(2,6-dioxomorpholin-4-yl)ethyl]-aminoacetic acid
CID 129887021
1-Propyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid
CID 54892939
1-Ethyl-4-(2,2,2-trifluoroethylamino)piperidine-4-carboxylic acid
CID 54893034
4-Fluoro-1-piperidin-4-ylpiperidine-4-carboxylic acid
CID 115037781
4-Dimethylamino-piperidine-4-carboxylic acid
CID 6484276
4-(2-Oxopiperidin-1-yl)piperidine-4-carboxylic acid
CID 14338263
1-Ethyl-4-(ethylamino)piperidine-4-carboxylic acid
CID 20622562
4-(Ethylamino)piperidine-4-carboxylic acid
CID 21905777
4-(Propan-2-ylamino)piperidine-4-carboxylic acid
CID 21905832
[1,4'-Bipiperidine]-4-carboxylic acid
CID 22722020

Frequently Asked Questions

What is the IUPAC name of 4-piperazin-1-ylpiperidine-4-carboxylic acid?
The IUPAC name of 4-piperazin-1-ylpiperidine-4-carboxylic acid (CID 61242816) is 4-piperazin-1-ylpiperidine-4-carboxylic acid.
What is the SMILES notation for 4-piperazin-1-ylpiperidine-4-carboxylic acid?
The canonical SMILES for 4-piperazin-1-ylpiperidine-4-carboxylic acid is O=C(O)C1(N2CCNCC2)CCNCC1.
What is the InChIKey of 4-piperazin-1-ylpiperidine-4-carboxylic acid?
The InChIKey is HPYAUWCUNUYIDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O2/c14-9(15)10(1-3-11-4-2-10)13-7-5-12-6-8-13/h11-12H,1-8H2,(H,14,15).
What are the key properties of 4-piperazin-1-ylpiperidine-4-carboxylic acid?
4-piperazin-1-ylpiperidine-4-carboxylic acid has a molecular weight of 213.28 g/mol, XLogP of -0.90, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-ylpiperidine-4-carboxylic acid is sourced from PubChem (CID 61242816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).