C12H18N2OS — CID 61242837
N-[(1-ethylpyrrolidin-3-yl)methyl]thiophene-2-carboxamide (PubChem CID 61242837) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-3-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[(1-ethylpyrrolidin-3-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61242837 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-[(1-ethylpyrrolidin-3-yl)methyl]thiophene-2-carboxamide |
| SMILES | CCN1CCC(CNC(=O)c2cccs2)C1 |
| InChI | InChI=1S/C12H18N2OS/c1-2-14-6-5-10(9-14)8-13-12(15)11-4-3-7-16-11/h3-4,7,10H,2,5-6,8-9H2,1H3,(H,13,15) |
| InChIKey | ICPCMTNGOUFLON-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |