C16H24N2O3S — CID 71632467
tert-butyl N-[[1-(2-oxo-2-thiophen-2-ylethyl)pyrrolidin-3-yl]methyl]carbamate (PubChem CID 71632467) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is tert-butyl N-[[1-(2-oxo-2-thiophen-2-ylethyl)pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(2-oxo-2-thiophen-2-ylethyl)pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71632467 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl N-[[1-(2-oxo-2-thiophen-2-ylethyl)pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(CC(=O)c2cccs2)C1 |
| InChI | InChI=1S/C16H24N2O3S/c1-16(2,3)21-15(20)17-9-12-6-7-18(10-12)11-13(19)14-5-4-8-22-14/h4-5,8,12H,6-7,9-11H2,1-3H3,(H,17,20) |
| InChIKey | OKPVGJJKAFLAAW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |