C8H17F2NO — CID 61246577
2-(2,2-difluoroethylamino)-4-methylpentan-1-ol (PubChem CID 61246577) has the molecular formula C8H17F2NO and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-4-methylpentan-1-ol.
| Compound Name | 2-(2,2-difluoroethylamino)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 61246577 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)NCC(F)F |
| InChI | InChI=1S/C8H17F2NO/c1-6(2)3-7(5-12)11-4-8(9)10/h6-8,11-12H,3-5H2,1-2H3 |
| InChIKey | DXAXVPYIHYXWTC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |