C10H20F3NO — CID 89162252
1,1,1-trifluoro-4-(2-methylpropylamino)hexan-2-ol (PubChem CID 89162252) has the molecular formula C10H20F3NO and a molecular weight of 227.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(2-methylpropylamino)hexan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-(2-methylpropylamino)hexan-2-ol |
|---|---|
| PubChem CID | 89162252 |
| Molecular Formula | C10H20F3NO |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1,1,1-trifluoro-4-(2-methylpropylamino)hexan-2-ol |
| SMILES | CCC(CC(O)C(F)(F)F)NCC(C)C |
| InChI | InChI=1S/C10H20F3NO/c1-4-8(14-6-7(2)3)5-9(15)10(11,12)13/h7-9,14-15H,4-6H2,1-3H3 |
| InChIKey | BBWBRZNXNFMARK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |