C11H22F3NO — CID 14379913
(2S,4R)-1,1,1-trifluoro-2-(methylamino)decan-4-ol (PubChem CID 14379913) has the molecular formula C11H22F3NO and a molecular weight of 241.30 g/mol. Its IUPAC name is (2S,4R)-1,1,1-trifluoro-2-(methylamino)decan-4-ol.
| Compound Name | (2S,4R)-1,1,1-trifluoro-2-(methylamino)decan-4-ol |
|---|---|
| PubChem CID | 14379913 |
| Molecular Formula | C11H22F3NO |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | (2S,4R)-1,1,1-trifluoro-2-(methylamino)decan-4-ol |
| SMILES | CCCCCC[C@@H](O)C[C@H](NC)C(F)(F)F |
| InChI | InChI=1S/C11H22F3NO/c1-3-4-5-6-7-9(16)8-10(15-2)11(12,13)14/h9-10,15-16H,3-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | FUBINHWHSSXRAP-ZJUUUORDSA-N |
| XLogP | 2.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|