C9H19F3N2O — CID 123310272
4-amino-1,1,1-trifluoro-6-(propan-2-ylamino)hexan-2-ol (PubChem CID 123310272) has the molecular formula C9H19F3N2O and a molecular weight of 228.26 g/mol. Its IUPAC name is 4-amino-1,1,1-trifluoro-6-(propan-2-ylamino)hexan-2-ol.
| Compound Name | 4-amino-1,1,1-trifluoro-6-(propan-2-ylamino)hexan-2-ol |
|---|---|
| PubChem CID | 123310272 |
| Molecular Formula | C9H19F3N2O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-amino-1,1,1-trifluoro-6-(propan-2-ylamino)hexan-2-ol |
| SMILES | CC(C)NCCC(N)CC(O)C(F)(F)F |
| InChI | InChI=1S/C9H19F3N2O/c1-6(2)14-4-3-7(13)5-8(15)9(10,11)12/h6-8,14-15H,3-5,13H2,1-2H3 |
| InChIKey | VJZSJMHOBANQAT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |