C13H25N5O2S — CID 61249309
5-methyl-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1H-pyrazole-4-sulfonamide (PubChem CID 61249309) has the molecular formula C13H25N5O2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 5-methyl-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61249309 |
| Molecular Formula | C13H25N5O2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 5-methyl-N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCC(C)(C)N1CCN(C)CC1 |
| InChI | InChI=1S/C13H25N5O2S/c1-11-12(9-14-16-11)21(19,20)15-10-13(2,3)18-7-5-17(4)6-8-18/h9,15H,5-8,10H2,1-4H3,(H,14,16) |
| InChIKey | FBJSGPHCDHHJGK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |