C14H18N4O — CID 61251851
N'-(2-methoxyphenyl)-N'-pyrimidin-4-ylpropane-1,3-diamine (PubChem CID 61251851) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N'-(2-methoxyphenyl)-N'-pyrimidin-4-ylpropane-1,3-diamine.
| Compound Name | N'-(2-methoxyphenyl)-N'-pyrimidin-4-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 61251851 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N'-(2-methoxyphenyl)-N'-pyrimidin-4-ylpropane-1,3-diamine |
| SMILES | COc1ccccc1N(CCCN)c1ccncn1 |
| InChI | InChI=1S/C14H18N4O/c1-19-13-6-3-2-5-12(13)18(10-4-8-15)14-7-9-16-11-17-14/h2-3,5-7,9,11H,4,8,10,15H2,1H3 |
| InChIKey | VPAGTDVTXSRDIO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |