C13H20BrN3O3S — CID 61254577
N-[(5-bromo-2-methoxyphenyl)methyl]-N-methylpiperazine-1-sulfonamide (PubChem CID 61254577) has the molecular formula C13H20BrN3O3S and a molecular weight of 378.29 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-N-methylpiperazine-1-sulfonamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61254577 |
| Molecular Formula | C13H20BrN3O3S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-N-methylpiperazine-1-sulfonamide |
| SMILES | COc1ccc(Br)cc1CN(C)S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C13H20BrN3O3S/c1-16(21(18,19)17-7-5-15-6-8-17)10-11-9-12(14)3-4-13(11)20-2/h3-4,9,15H,5-8,10H2,1-2H3 |
| InChIKey | JRSHFWYTRRTFEV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |