C13H16N4O3S — CID 61259959
3,5-dimethyl-N-[4-(sulfamoylmethyl)phenyl]-1H-pyrazole-4-carboxamide (PubChem CID 61259959) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 3,5-dimethyl-N-[4-(sulfamoylmethyl)phenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 3,5-dimethyl-N-[4-(sulfamoylmethyl)phenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 61259959 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3,5-dimethyl-N-[4-(sulfamoylmethyl)phenyl]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)Nc1ccc(CS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H16N4O3S/c1-8-12(9(2)17-16-8)13(18)15-11-5-3-10(4-6-11)7-21(14,19)20/h3-6H,7H2,1-2H3,(H,15,18)(H,16,17)(H2,14,19,20) |
| InChIKey | JQEYJFVUJLFTAJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |