C18H21NO2 — CID 61262577
3-[1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]aniline (PubChem CID 61262577) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-[1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]aniline.
| Compound Name | 3-[1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]aniline |
|---|---|
| PubChem CID | 61262577 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 3-[1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]aniline |
| SMILES | CC(Oc1cccc2c1OC(C)(C)C2)c1cccc(N)c1 |
| InChI | InChI=1S/C18H21NO2/c1-12(13-6-4-8-15(19)10-13)20-16-9-5-7-14-11-18(2,3)21-17(14)16/h4-10,12H,11,19H2,1-3H3 |
| InChIKey | KRKKCGLYWAKSSW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|