C16H13F2NO2 — CID 61263642
(2,4-difluorophenyl)-(6-methoxy-1-benzofuran-2-yl)methanamine (PubChem CID 61263642) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(6-methoxy-1-benzofuran-2-yl)methanamine.
| Compound Name | (2,4-difluorophenyl)-(6-methoxy-1-benzofuran-2-yl)methanamine |
|---|---|
| PubChem CID | 61263642 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (2,4-difluorophenyl)-(6-methoxy-1-benzofuran-2-yl)methanamine |
| SMILES | COc1ccc2cc(C(N)c3ccc(F)cc3F)oc2c1 |
| InChI | InChI=1S/C16H13F2NO2/c1-20-11-4-2-9-6-15(21-14(9)8-11)16(19)12-5-3-10(17)7-13(12)18/h2-8,16H,19H2,1H3 |
| InChIKey | FBIPSFJGRPAKOH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |