C10H17NO6S — CID 61272830
4-methylsulfonyl-2-(oxolane-3-carbonylamino)butanoic acid (PubChem CID 61272830) has the molecular formula C10H17NO6S and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-methylsulfonyl-2-(oxolane-3-carbonylamino)butanoic acid.
| Compound Name | 4-methylsulfonyl-2-(oxolane-3-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 61272830 |
| Molecular Formula | C10H17NO6S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-methylsulfonyl-2-(oxolane-3-carbonylamino)butanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)C1CCOC1)C(=O)O |
| InChI | InChI=1S/C10H17NO6S/c1-18(15,16)5-3-8(10(13)14)11-9(12)7-2-4-17-6-7/h7-8H,2-6H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | QPUJNZCLCGDKMR-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |