C10H18N2O6S — CID 66235445
2-[(4-aminooxolane-3-carbonyl)amino]-4-methylsulfonylbutanoic acid (PubChem CID 66235445) has the molecular formula C10H18N2O6S and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-[(4-aminooxolane-3-carbonyl)amino]-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[(4-aminooxolane-3-carbonyl)amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 66235445 |
| Molecular Formula | C10H18N2O6S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[(4-aminooxolane-3-carbonyl)amino]-4-methylsulfonylbutanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)C1COCC1N)C(=O)O |
| InChI | InChI=1S/C10H18N2O6S/c1-19(16,17)3-2-8(10(14)15)12-9(13)6-4-18-5-7(6)11/h6-8H,2-5,11H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | KZESWFMPOVNDDM-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |