C13H19NO5S — CID 43104112
2-(bicyclo[2.2.1]hept-5-ene-2-carbonylamino)-4-methylsulfonylbutanoic acid (PubChem CID 43104112) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 2-(bicyclo[2.2.1]hept-5-ene-2-carbonylamino)-4-methylsulfonylbutanoic acid.
| Compound Name | 2-(bicyclo[2.2.1]hept-5-ene-2-carbonylamino)-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 43104112 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-(bicyclo[2.2.1]hept-5-ene-2-carbonylamino)-4-methylsulfonylbutanoic acid |
| SMILES | CS(=O)(=O)CCC(NC(=O)C1CC2C=CC1C2)C(=O)O |
| InChI | InChI=1S/C13H19NO5S/c1-20(18,19)5-4-11(13(16)17)14-12(15)10-7-8-2-3-9(10)6-8/h2-3,8-11H,4-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | LKOPCJZDULBUTP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|