C14H16N4O2S — CID 61273443
2-amino-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanediamide (PubChem CID 61273443) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-amino-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanediamide.
| Compound Name | 2-amino-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanediamide |
|---|---|
| PubChem CID | 61273443 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-amino-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanediamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)C(N)CC(N)=O)cc2)cs1 |
| InChI | InChI=1S/C14H16N4O2S/c1-8-17-12(7-21-8)9-2-4-10(5-3-9)18-14(20)11(15)6-13(16)19/h2-5,7,11H,6,15H2,1H3,(H2,16,19)(H,18,20) |
| InChIKey | WIUNMUOKIXBORM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |