C12H15N5O3S — CID 61275594
1-methyl-3-[4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]phenyl]urea (PubChem CID 61275594) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is 1-methyl-3-[4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]phenyl]urea.
| Compound Name | 1-methyl-3-[4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 61275594 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-methyl-3-[4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]phenyl]urea |
| SMILES | CNC(=O)Nc1ccc(NS(=O)(=O)c2cn[nH]c2C)cc1 |
| InChI | InChI=1S/C12H15N5O3S/c1-8-11(7-14-16-8)21(19,20)17-10-5-3-9(4-6-10)15-12(18)13-2/h3-7,17H,1-2H3,(H,14,16)(H2,13,15,18) |
| InChIKey | SDTNHWQKYPDEGA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |