C12H24N4O2 — CID 61275785
2-amino-N-(1-propylpiperidin-4-yl)butanediamide (PubChem CID 61275785) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-amino-N-(1-propylpiperidin-4-yl)butanediamide.
| Compound Name | 2-amino-N-(1-propylpiperidin-4-yl)butanediamide |
|---|---|
| PubChem CID | 61275785 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-amino-N-(1-propylpiperidin-4-yl)butanediamide |
| SMILES | CCCN1CCC(NC(=O)C(N)CC(N)=O)CC1 |
| InChI | InChI=1S/C12H24N4O2/c1-2-5-16-6-3-9(4-7-16)15-12(18)10(13)8-11(14)17/h9-10H,2-8,13H2,1H3,(H2,14,17)(H,15,18) |
| InChIKey | UDLFYNCNCSMAGO-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |