C13H20N6O2 — CID 60846790
2-amino-N-(1-pyrimidin-2-ylpiperidin-4-yl)butanediamide (PubChem CID 60846790) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-amino-N-(1-pyrimidin-2-ylpiperidin-4-yl)butanediamide.
| Compound Name | 2-amino-N-(1-pyrimidin-2-ylpiperidin-4-yl)butanediamide |
|---|---|
| PubChem CID | 60846790 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-amino-N-(1-pyrimidin-2-ylpiperidin-4-yl)butanediamide |
| SMILES | NC(=O)CC(N)C(=O)NC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C13H20N6O2/c14-10(8-11(15)20)12(21)18-9-2-6-19(7-3-9)13-16-4-1-5-17-13/h1,4-5,9-10H,2-3,6-8,14H2,(H2,15,20)(H,18,21) |
| InChIKey | ZAYBQNAGONPFIY-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |