C13H18N4O3S — CID 61276279
N-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-1H-pyrazole-4-sulfonamide (PubChem CID 61276279) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61276279 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[5-[(dimethylamino)methyl]-2-methoxyphenyl]-1H-pyrazole-4-sulfonamide |
| SMILES | COc1ccc(CN(C)C)cc1NS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C13H18N4O3S/c1-17(2)9-10-4-5-13(20-3)12(6-10)16-21(18,19)11-7-14-15-8-11/h4-8,16H,9H2,1-3H3,(H,14,15) |
| InChIKey | NQNCEJFZFYYCKM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |