About (2-methylcyclohexyl) 2-aminoacetate
(2-methylcyclohexyl) 2-aminoacetate (PubChem CID 61277228) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is (2-methylcyclohexyl) 2-aminoacetate.
Molecular Properties
| Compound Name | (2-methylcyclohexyl) 2-aminoacetate |
| PubChem CID | 61277228 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (2-methylcyclohexyl) 2-aminoacetate |
| SMILES | CC1CCCCC1OC(=O)CN |
| InChI | InChI=1S/C9H17NO2/c1-7-4-2-3-5-8(7)12-9(11)6-10/h7-8H,2-6,10H2,1H3 |
| InChIKey | BUVNOWJVEYCWRO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylcyclohexyl) 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexyl) 2-aminoacetate?
The IUPAC name of (2-methylcyclohexyl) 2-aminoacetate (CID 61277228) is (2-methylcyclohexyl) 2-aminoacetate.
What is the SMILES notation for (2-methylcyclohexyl) 2-aminoacetate?
The canonical SMILES for (2-methylcyclohexyl) 2-aminoacetate is CC1CCCCC1OC(=O)CN.
What is the InChIKey of (2-methylcyclohexyl) 2-aminoacetate?
The InChIKey is BUVNOWJVEYCWRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-7-4-2-3-5-8(7)12-9(11)6-10/h7-8H,2-6,10H2,1H3.
What are the key properties of (2-methylcyclohexyl) 2-aminoacetate?
(2-methylcyclohexyl) 2-aminoacetate has a molecular weight of 171.24 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexyl) 2-aminoacetate is sourced from PubChem (CID 61277228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).