About (4-methylcyclohexyl) 2-amino-4-methylpentanoate
(4-methylcyclohexyl) 2-amino-4-methylpentanoate (PubChem CID 61279653) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is (4-methylcyclohexyl) 2-amino-4-methylpentanoate.
Molecular Properties
| Compound Name | (4-methylcyclohexyl) 2-amino-4-methylpentanoate |
| PubChem CID | 61279653 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (4-methylcyclohexyl) 2-amino-4-methylpentanoate |
| SMILES | CC(C)CC(N)C(=O)OC1CCC(C)CC1 |
| InChI | InChI=1S/C13H25NO2/c1-9(2)8-12(14)13(15)16-11-6-4-10(3)5-7-11/h9-12H,4-8,14H2,1-3H3 |
| InChIKey | JRWNGWPLGYSDIZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methylcyclohexyl) 2-amino-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylcyclohexyl) 2-amino-4-methylpentanoate?
The IUPAC name of (4-methylcyclohexyl) 2-amino-4-methylpentanoate (CID 61279653) is (4-methylcyclohexyl) 2-amino-4-methylpentanoate.
What is the SMILES notation for (4-methylcyclohexyl) 2-amino-4-methylpentanoate?
The canonical SMILES for (4-methylcyclohexyl) 2-amino-4-methylpentanoate is CC(C)CC(N)C(=O)OC1CCC(C)CC1.
What is the InChIKey of (4-methylcyclohexyl) 2-amino-4-methylpentanoate?
The InChIKey is JRWNGWPLGYSDIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-9(2)8-12(14)13(15)16-11-6-4-10(3)5-7-11/h9-12H,4-8,14H2,1-3H3.
What are the key properties of (4-methylcyclohexyl) 2-amino-4-methylpentanoate?
(4-methylcyclohexyl) 2-amino-4-methylpentanoate has a molecular weight of 227.35 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylcyclohexyl) 2-amino-4-methylpentanoate is sourced from PubChem (CID 61279653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).