About piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride
piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride (PubChem CID 173188799) has the molecular formula C11H24Cl2N2O2
and a molecular weight of 287.23 g/mol. Its IUPAC name is piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride.
Molecular Properties
| Compound Name | piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride |
| PubChem CID | 173188799 |
| Molecular Formula | C11H24Cl2N2O2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)OC1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C11H22N2O2.2ClH/c1-8(2)7-10(12)11(14)15-9-3-5-13-6-4-9;;/h8-10,13H,3-7,12H2,1-2H3;2*1H/t10-;;/m0../s1 |
| InChIKey | ZDRNGCFCEZRTFB-XRIOVQLTSA-N |
| XLogP | 1.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride?
The IUPAC name of piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride (CID 173188799) is piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride.
What is the SMILES notation for piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride?
The canonical SMILES for piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride is CC(C)C[C@H](N)C(=O)OC1CCNCC1.Cl.Cl.
What is the InChIKey of piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride?
The InChIKey is ZDRNGCFCEZRTFB-XRIOVQLTSA-N. The full InChI is InChI=1S/C11H22N2O2.2ClH/c1-8(2)7-10(12)11(14)15-9-3-5-13-6-4-9;;/h8-10,13H,3-7,12H2,1-2H3;2*1H/t10-;;/m0../s1.
What are the key properties of piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride?
piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride has a molecular weight of 287.23 g/mol, XLogP of 1.50, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl (2S)-2-amino-4-methylpentanoate;dihydrochloride is sourced from PubChem (CID 173188799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).