About cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride
cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride (PubChem CID 89497653) has the molecular formula C15H30Cl2N2O2
and a molecular weight of 341.32 g/mol. Its IUPAC name is cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride.
Molecular Properties
| Compound Name | cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride |
| PubChem CID | 89497653 |
| Molecular Formula | C15H30Cl2N2O2 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride |
| SMILES | CC(C)C[C@@H](NC1CCNC1)C(=O)OC1CCCC1.Cl.Cl |
| InChI | InChI=1S/C15H28N2O2.2ClH/c1-11(2)9-14(17-12-7-8-16-10-12)15(18)19-13-5-3-4-6-13;;/h11-14,16-17H,3-10H2,1-2H3;2*1H/t12?,14-;;/m1../s1 |
| InChIKey | ILLCFCBHGCHCBR-FVLCQKEPSA-N |
| XLogP | 2.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride?
The IUPAC name of cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride (CID 89497653) is cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride.
What is the SMILES notation for cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride?
The canonical SMILES for cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride is CC(C)C[C@@H](NC1CCNC1)C(=O)OC1CCCC1.Cl.Cl.
What is the InChIKey of cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride?
The InChIKey is ILLCFCBHGCHCBR-FVLCQKEPSA-N. The full InChI is InChI=1S/C15H28N2O2.2ClH/c1-11(2)9-14(17-12-7-8-16-10-12)15(18)19-13-5-3-4-6-13;;/h11-14,16-17H,3-10H2,1-2H3;2*1H/t12?,14-;;/m1../s1.
What are the key properties of cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride?
cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride has a molecular weight of 341.32 g/mol, XLogP of 2.68, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl (2R)-4-methyl-2-(pyrrolidin-3-ylamino)pentanoate;dihydrochloride is sourced from PubChem (CID 89497653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).