C9H13N5S — CID 61281741
N-[[2-(1H-1,2,4-triazol-5-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 61281741) has the molecular formula C9H13N5S and a molecular weight of 223.30 g/mol. Its IUPAC name is N-[[2-(1H-1,2,4-triazol-5-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(1H-1,2,4-triazol-5-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 61281741 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-[[2-(1H-1,2,4-triazol-5-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(-c2ncn[nH]2)s1 |
| InChI | InChI=1S/C9H13N5S/c1-2-3-10-4-7-5-11-9(15-7)8-12-6-13-14-8/h5-6,10H,2-4H2,1H3,(H,12,13,14) |
| InChIKey | BJJRSJGBOJPMCX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|