C13H10BrF2NOS — CID 61289437
3-bromo-4-[(2,5-difluorophenyl)sulfinylmethyl]aniline (PubChem CID 61289437) has the molecular formula C13H10BrF2NOS and a molecular weight of 346.20 g/mol. Its IUPAC name is 3-bromo-4-[(2,5-difluorophenyl)sulfinylmethyl]aniline.
| Compound Name | 3-bromo-4-[(2,5-difluorophenyl)sulfinylmethyl]aniline |
|---|---|
| PubChem CID | 61289437 |
| Molecular Formula | C13H10BrF2NOS |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 3-bromo-4-[(2,5-difluorophenyl)sulfinylmethyl]aniline |
| SMILES | Nc1ccc(CS(=O)c2cc(F)ccc2F)c(Br)c1 |
| InChI | InChI=1S/C13H10BrF2NOS/c14-11-6-10(17)3-1-8(11)7-19(18)13-5-9(15)2-4-12(13)16/h1-6H,7,17H2 |
| InChIKey | XGUKIWTVRHWYDH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|