C22H23N3O2S4 — CID 6128977
(5Z)-2-butyl-5-[(5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-3-sulfanylidene-1,2-thiazolidin-4-one (PubChem CID 6128977) has the molecular formula C22H23N3O2S4 and a molecular weight of 489.71 g/mol. Its IUPAC name is (5Z)-2-butyl-5-[(5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-3-sulfanylidene-1,2-thiazolidin-4-one.
| Compound Name | (5Z)-2-butyl-5-[(5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-3-sulfanylidene-1,2-thiazolidin-4-one |
|---|---|
| PubChem CID | 6128977 |
| Molecular Formula | C22H23N3O2S4 |
| Molecular Weight | 489.71 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | (5Z)-2-butyl-5-[(5Z)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-3-sulfanylidene-1,2-thiazolidin-4-one |
| SMILES | C=CCn1c(=O)/c(=C2/Sc3ccccc3N2CC)s/c1=C1\SN(CCCC)C(=S)C1=O |
| InChI | InChI=1S/C22H23N3O2S4/c1-4-7-13-25-20(28)16(26)17(31-25)21-24(12-5-2)19(27)18(30-21)22-23(6-3)14-10-8-9-11-15(14)29-22/h5,8-11H,2,4,6-7,12-13H2,1,3H3/b21-17-,22-18- |
| InChIKey | ZSDPFKDLDFJCBF-SVJWQLCWSA-N |
| XLogP | 3.56 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.71 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|