C24H20N4O2S2 — CID 7101740
(5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 7101740) has the molecular formula C24H20N4O2S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7101740 |
| Molecular Formula | C24H20N4O2S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (5Z)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCn1c(=C2C(=O)N(c3ccccc3)N=C2C)s/c(=C2\Sc3ccccc3N2C)c1=O |
| InChI | InChI=1S/C24H20N4O2S2/c1-4-14-27-22(30)20(24-26(3)17-12-8-9-13-18(17)31-24)32-23(27)19-15(2)25-28(21(19)29)16-10-6-5-7-11-16/h4-13H,1,14H2,2-3H3/b23-19?,24-20- |
| InChIKey | DDRKZQQQIKMEQQ-KIFPSFBBSA-N |
| XLogP | 2.98 |
| TPSA | 57.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|